C19H26F3N3O3S — CID 25069817
1-cyclohexyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]urea (PubChem CID 25069817) has the molecular formula C19H26F3N3O3S and a molecular weight of 433.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]urea |
|---|---|
| PubChem CID | 25069817 |
| Molecular Formula | C19H26F3N3O3S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-cyclohexyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]urea |
| SMILES | O=C(NC1CCCCC1)NC1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H26F3N3O3S/c20-19(21,22)14-5-4-8-17(13-14)29(27,28)25-11-9-16(10-12-25)24-18(26)23-15-6-2-1-3-7-15/h4-5,8,13,15-16H,1-3,6-7,9-12H2,(H2,23,24,26) |
| InChIKey | HPZWPFTXQTXZMF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |