C18H24F3N3O4S — CID 58235361
1-cyclohexyl-3-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea (PubChem CID 58235361) has the molecular formula C18H24F3N3O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea.
| Compound Name | 1-cyclohexyl-3-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea |
|---|---|
| PubChem CID | 58235361 |
| Molecular Formula | C18H24F3N3O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-cyclohexyl-3-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea |
| SMILES | O=C(NO[C@@H]1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1)NC1CCCCC1 |
| InChI | InChI=1S/C18H24F3N3O4S/c19-18(20,21)13-5-4-8-16(11-13)29(26,27)24-10-9-15(12-24)28-23-17(25)22-14-6-2-1-3-7-14/h4-5,8,11,14-15H,1-3,6-7,9-10,12H2,(H2,22,23,25)/t15-/m1/s1 |
| InChIKey | DZSKLPKDGBCVJK-OAHLLOKOSA-N |
| XLogP | 3.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|