C13H16F3NO3S — CID 115745003
2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]ethanol (PubChem CID 115745003) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]ethanol.
| Compound Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 115745003 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]ethanol |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCC(CCO)C1 |
| InChI | InChI=1S/C13H16F3NO3S/c14-13(15,16)11-2-1-3-12(8-11)21(19,20)17-6-4-10(9-17)5-7-18/h1-3,8,10,18H,4-7,9H2 |
| InChIKey | UJCVFFCNVQNOTQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |