C13H14F3NO5S — CID 59820106
2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyacetic acid (PubChem CID 59820106) has the molecular formula C13H14F3NO5S and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 59820106 |
| Molecular Formula | C13H14F3NO5S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyacetic acid |
| SMILES | O=C(O)COC1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H14F3NO5S/c14-13(15,16)9-2-1-3-11(6-9)23(20,21)17-5-4-10(7-17)22-8-12(18)19/h1-3,6,10H,4-5,7-8H2,(H,18,19) |
| InChIKey | KKSGCPDMLWPJBK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |