C15H17F3N2O4S — CID 58235446
N-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxycyclopropanecarboxamide (PubChem CID 58235446) has the molecular formula C15H17F3N2O4S and a molecular weight of 378.37 g/mol. Its IUPAC name is N-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxycyclopropanecarboxamide.
| Compound Name | N-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxycyclopropanecarboxamide |
|---|---|
| PubChem CID | 58235446 |
| Molecular Formula | C15H17F3N2O4S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[(3R)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxycyclopropanecarboxamide |
| SMILES | O=C(NO[C@@H]1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1)C1CC1 |
| InChI | InChI=1S/C15H17F3N2O4S/c16-15(17,18)11-2-1-3-13(8-11)25(22,23)20-7-6-12(9-20)24-19-14(21)10-4-5-10/h1-3,8,10,12H,4-7,9H2,(H,19,21)/t12-/m1/s1 |
| InChIKey | JNBPAFKYVQGUFR-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|