C17H23F3N2O4S — CID 24686101
N-(3-methoxypropyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 24686101) has the molecular formula C17H23F3N2O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24686101 |
| Molecular Formula | C17H23F3N2O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(3-methoxypropyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H23F3N2O4S/c1-26-11-3-8-21-16(23)13-6-9-22(10-7-13)27(24,25)15-5-2-4-14(12-15)17(18,19)20/h2,4-5,12-13H,3,6-11H2,1H3,(H,21,23) |
| InChIKey | LDLLKSIAMHKDNW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|