C21H23F3N2O4S — CID 55803251
1-(benzenesulfonyl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide (PubChem CID 55803251) has the molecular formula C21H23F3N2O4S and a molecular weight of 456.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55803251 |
| Molecular Formula | C21H23F3N2O4S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCOc1cccc(C(F)(F)F)c1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23F3N2O4S/c22-21(23,24)17-5-4-6-18(15-17)30-14-11-25-20(27)16-9-12-26(13-10-16)31(28,29)19-7-2-1-3-8-19/h1-8,15-16H,9-14H2,(H,25,27) |
| InChIKey | CQQNVXKFZIBKAO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|