C20H22Cl2N2O4S — CID 26903277
1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenoxyethyl)piperidine-4-carboxamide (PubChem CID 26903277) has the molecular formula C20H22Cl2N2O4S and a molecular weight of 457.38 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenoxyethyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26903277 |
| Molecular Formula | C20H22Cl2N2O4S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-phenoxyethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H22Cl2N2O4S/c21-16-6-7-18(22)19(14-16)29(26,27)24-11-8-15(9-12-24)20(25)23-10-13-28-17-4-2-1-3-5-17/h1-7,14-15H,8-13H2,(H,23,25) |
| InChIKey | BQXATLTZFKXNEW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|