C16H22Cl2N2O4S — CID 2187606
1-(2,5-dichlorophenyl)sulfonyl-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 2187606) has the molecular formula C16H22Cl2N2O4S and a molecular weight of 409.34 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2187606 |
| Molecular Formula | C16H22Cl2N2O4S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H22Cl2N2O4S/c1-24-10-2-7-19-16(21)12-5-8-20(9-6-12)25(22,23)15-11-13(17)3-4-14(15)18/h3-4,11-12H,2,5-10H2,1H3,(H,19,21) |
| InChIKey | ZYPIVXIWJUIYPQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|