C18H25Cl2N3O3 — CID 55988353
1-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55988353) has the molecular formula C18H25Cl2N3O3 and a molecular weight of 402.32 g/mol. Its IUPAC name is 1-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55988353 |
| Molecular Formula | C18H25Cl2N3O3 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(CC(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H25Cl2N3O3/c1-26-10-2-7-21-18(25)13-5-8-23(9-6-13)12-17(24)22-16-11-14(19)3-4-15(16)20/h3-4,11,13H,2,5-10,12H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | XAVODSXPZOMPGR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|