C21H34N4O5S — CID 55989659
1-[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55989659) has the molecular formula C21H34N4O5S and a molecular weight of 454.59 g/mol. Its IUPAC name is 1-[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55989659 |
| Molecular Formula | C21H34N4O5S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(CC(=O)Nc2ccc(C)c(S(=O)(=O)N(C)C)c2)CC1 |
| InChI | InChI=1S/C21H34N4O5S/c1-16-6-7-18(14-19(16)31(28,29)24(2)3)23-20(26)15-25-11-8-17(9-12-25)21(27)22-10-5-13-30-4/h6-7,14,17H,5,8-13,15H2,1-4H3,(H,22,27)(H,23,26) |
| InChIKey | JXKLPCQILXPMEE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|