C25H33N3O4S — CID 16605869
2-(4-benzoylpiperidin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 16605869) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 2-(4-benzoylpiperidin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide.
| Compound Name | 2-(4-benzoylpiperidin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 16605869 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-(4-benzoylpiperidin-1-yl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CN2CCC(C(=O)c3ccccc3)CC2)ccc1C |
| InChI | InChI=1S/C25H33N3O4S/c1-4-28(5-2)33(31,32)23-17-22(12-11-19(23)3)26-24(29)18-27-15-13-21(14-16-27)25(30)20-9-7-6-8-10-20/h6-12,17,21H,4-5,13-16,18H2,1-3H3,(H,26,29) |
| InChIKey | YEWPUMYFOHYOPF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |