C20H31N3O2 — CID 16909784
N-butyl-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 16909784) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-butyl-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16909784 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-butyl-1-[2-(3,4-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(CC(=O)Nc2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-4-5-10-21-20(25)17-8-11-23(12-9-17)14-19(24)22-18-7-6-15(2)16(3)13-18/h6-7,13,17H,4-5,8-12,14H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | WTNPHMOZBBSIHH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|