C18H24Cl3N3O3 — CID 55988482
N-(3-methoxypropyl)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxamide (PubChem CID 55988482) has the molecular formula C18H24Cl3N3O3 and a molecular weight of 436.77 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55988482 |
| Molecular Formula | C18H24Cl3N3O3 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-(3-methoxypropyl)-1-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H24Cl3N3O3/c1-27-8-2-5-22-18(26)12-3-6-24(7-4-12)11-17(25)23-16-10-14(20)13(19)9-15(16)21/h9-10,12H,2-8,11H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | FCLHQRKNYJAPNI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|