C17H32N4O4 — CID 55911947
1-[2-(butylcarbamoylamino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55911947) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[2-(butylcarbamoylamino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(butylcarbamoylamino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55911947 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1-[2-(butylcarbamoylamino)-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)NC(=O)CN1CCC(C(=O)NCCCOC)CC1 |
| InChI | InChI=1S/C17H32N4O4/c1-3-4-8-19-17(24)20-15(22)13-21-10-6-14(7-11-21)16(23)18-9-5-12-25-2/h14H,3-13H2,1-2H3,(H,18,23)(H2,19,20,22,24) |
| InChIKey | DZRDDKIYGLBYMR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|