C20H37N3O3 — CID 55909529
1-[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55909529) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is 1-[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55909529 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 1-[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(CC(=O)NC2CCCC(C)C2C)CC1 |
| InChI | InChI=1S/C20H37N3O3/c1-15-6-4-7-18(16(15)2)22-19(24)14-23-11-8-17(9-12-23)20(25)21-10-5-13-26-3/h15-18H,4-14H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | WQVSOBNPMKSAPM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|