C12H22N5O2- — CID 59123598
[(E)-[4-(butylcarbamoyl)piperidin-1-yl]methoxymethylidenehydrazinylidene]azanide (PubChem CID 59123598) has the molecular formula C12H22N5O2- and a molecular weight of 268.34 g/mol. Its IUPAC name is [(E)-[4-(butylcarbamoyl)piperidin-1-yl]methoxymethylidenehydrazinylidene]azanide.
| Compound Name | [(E)-[4-(butylcarbamoyl)piperidin-1-yl]methoxymethylidenehydrazinylidene]azanide |
|---|---|
| PubChem CID | 59123598 |
| Molecular Formula | C12H22N5O2- |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [(E)-[4-(butylcarbamoyl)piperidin-1-yl]methoxymethylidenehydrazinylidene]azanide |
| SMILES | CCCCNC(=O)C1CCN(CO/C=N/N=[N-])CC1 |
| InChI | InChI=1S/C12H22N5O2/c1-2-3-6-14-12(18)11-4-7-17(8-5-11)10-19-9-15-16-13/h9,11H,2-8,10H2,1H3,(H,14,18)/q-1/b15-9+ |
| InChIKey | RRDVAWUAWYBPFU-OQLLNIDSSA-N |
| XLogP | 1.55 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|