C12H22N2O2 — CID 3067803
N-[4-(butylamino)-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 3067803) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N-[4-(butylamino)-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-(butylamino)-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3067803 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-[4-(butylamino)-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | CCCCNC(=O)CCCNC(=O)C1CC1 |
| InChI | InChI=1S/C12H22N2O2/c1-2-3-8-13-11(15)5-4-9-14-12(16)10-6-7-10/h10H,2-9H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | IEFFKQHRPWXWGU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|