C14H27N3O2 — CID 119641529
N-[4-[(2-amino-2-ethylbutyl)amino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 119641529) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-[4-[(2-amino-2-ethylbutyl)amino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(2-amino-2-ethylbutyl)amino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 119641529 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-[4-[(2-amino-2-ethylbutyl)amino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | CCC(N)(CC)CNC(=O)CCCNC(=O)C1CC1 |
| InChI | InChI=1S/C14H27N3O2/c1-3-14(15,4-2)10-17-12(18)6-5-9-16-13(19)11-7-8-11/h11H,3-10,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | ULGWUSSZYNAWOC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|