C13H28ClN3O2 — CID 119643328
N'-(2-amino-2-ethylbutyl)-N-ethylpentanediamide;hydrochloride (PubChem CID 119643328) has the molecular formula C13H28ClN3O2 and a molecular weight of 293.84 g/mol. Its IUPAC name is N'-(2-amino-2-ethylbutyl)-N-ethylpentanediamide;hydrochloride.
| Compound Name | N'-(2-amino-2-ethylbutyl)-N-ethylpentanediamide;hydrochloride |
|---|---|
| PubChem CID | 119643328 |
| Molecular Formula | C13H28ClN3O2 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N'-(2-amino-2-ethylbutyl)-N-ethylpentanediamide;hydrochloride |
| SMILES | CCNC(=O)CCCC(=O)NCC(N)(CC)CC.Cl |
| InChI | InChI=1S/C13H27N3O2.ClH/c1-4-13(14,5-2)10-16-12(18)9-7-8-11(17)15-6-3;/h4-10,14H2,1-3H3,(H,15,17)(H,16,18);1H |
| InChIKey | MLKVUIDVCQIXGR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |