C12H29Cl2N3O — CID 119640041
N-(2-amino-2-ethylbutyl)-2-(diethylamino)acetamide;dihydrochloride (PubChem CID 119640041) has the molecular formula C12H29Cl2N3O and a molecular weight of 302.29 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-(diethylamino)acetamide;dihydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-(diethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119640041 |
| Molecular Formula | C12H29Cl2N3O |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-(diethylamino)acetamide;dihydrochloride |
| SMILES | CCN(CC)CC(=O)NCC(N)(CC)CC.Cl.Cl |
| InChI | InChI=1S/C12H27N3O.2ClH/c1-5-12(13,6-2)10-14-11(16)9-15(7-3)8-4;;/h5-10,13H2,1-4H3,(H,14,16);2*1H |
| InChIKey | WRFWSBUNTDMDSD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |