C15H34Cl2N4O2 — CID 24832330
2-(diethylamino)-N-[3-[[2-(diethylamino)acetyl]amino]propyl]acetamide;dihydrochloride (PubChem CID 24832330) has the molecular formula C15H34Cl2N4O2 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-(diethylamino)-N-[3-[[2-(diethylamino)acetyl]amino]propyl]acetamide;dihydrochloride.
| Compound Name | 2-(diethylamino)-N-[3-[[2-(diethylamino)acetyl]amino]propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 24832330 |
| Molecular Formula | C15H34Cl2N4O2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-(diethylamino)-N-[3-[[2-(diethylamino)acetyl]amino]propyl]acetamide;dihydrochloride |
| SMILES | CCN(CC)CC(=O)NCCCNC(=O)CN(CC)CC.Cl.Cl |
| InChI | InChI=1S/C15H32N4O2.2ClH/c1-5-18(6-2)12-14(20)16-10-9-11-17-15(21)13-19(7-3)8-4;;/h5-13H2,1-4H3,(H,16,20)(H,17,21);2*1H |
| InChIKey | FYNPTEHHCCCTJC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|