C13H29N3OS2 — CID 10047882
2-[3-(diethylamino)propyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide (PubChem CID 10047882) has the molecular formula C13H29N3OS2 and a molecular weight of 307.53 g/mol. Its IUPAC name is 2-[3-(diethylamino)propyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide.
| Compound Name | 2-[3-(diethylamino)propyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide |
|---|---|
| PubChem CID | 10047882 |
| Molecular Formula | C13H29N3OS2 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[3-(diethylamino)propyl-(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide |
| SMILES | CCN(CC)CCCN(CCS)CC(=O)NCCS |
| InChI | InChI=1S/C13H29N3OS2/c1-3-15(4-2)7-5-8-16(9-11-19)12-13(17)14-6-10-18/h18-19H,3-12H2,1-2H3,(H,14,17) |
| InChIKey | GZUSPBCUTALQDD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|