C12H26N2OS2 — CID 100944879
2-[hexyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide (PubChem CID 100944879) has the molecular formula C12H26N2OS2 and a molecular weight of 278.49 g/mol. Its IUPAC name is 2-[hexyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide.
| Compound Name | 2-[hexyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide |
|---|---|
| PubChem CID | 100944879 |
| Molecular Formula | C12H26N2OS2 |
| Molecular Weight | 278.49 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[hexyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)acetamide |
| SMILES | CCCCCCN(CCS)CC(=O)NCCS |
| InChI | InChI=1S/C12H26N2OS2/c1-2-3-4-5-7-14(8-10-17)11-12(15)13-6-9-16/h16-17H,2-11H2,1H3,(H,13,15) |
| InChIKey | NHPLODDLCZQPJD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|