C11H24N2OS2 — CID 58811044
3-[butyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)propanamide (PubChem CID 58811044) has the molecular formula C11H24N2OS2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 3-[butyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)propanamide.
| Compound Name | 3-[butyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 58811044 |
| Molecular Formula | C11H24N2OS2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[butyl(2-sulfanylethyl)amino]-N-(2-sulfanylethyl)propanamide |
| SMILES | CCCCN(CCS)CCC(=O)NCCS |
| InChI | InChI=1S/C11H24N2OS2/c1-2-3-6-13(8-10-16)7-4-11(14)12-5-9-15/h15-16H,2-10H2,1H3,(H,12,14) |
| InChIKey | DJLRBDICVPTOEL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|