C16H31N5O4S — CID 58991254
N-(2-acetamidoethyl)-3-[[3-(2-acetamidoethylamino)-3-oxopropyl]-(2-sulfanylethyl)amino]propanamide (PubChem CID 58991254) has the molecular formula C16H31N5O4S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-[[3-(2-acetamidoethylamino)-3-oxopropyl]-(2-sulfanylethyl)amino]propanamide.
| Compound Name | N-(2-acetamidoethyl)-3-[[3-(2-acetamidoethylamino)-3-oxopropyl]-(2-sulfanylethyl)amino]propanamide |
|---|---|
| PubChem CID | 58991254 |
| Molecular Formula | C16H31N5O4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-(2-acetamidoethyl)-3-[[3-(2-acetamidoethylamino)-3-oxopropyl]-(2-sulfanylethyl)amino]propanamide |
| SMILES | CC(=O)NCCNC(=O)CCN(CCS)CCC(=O)NCCNC(C)=O |
| InChI | InChI=1S/C16H31N5O4S/c1-13(22)17-5-7-19-15(24)3-9-21(11-12-26)10-4-16(25)20-8-6-18-14(2)23/h26H,3-12H2,1-2H3,(H,17,22)(H,18,23)(H,19,24)(H,20,25) |
| InChIKey | JRCCWSAQOROFKG-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|