C8H15N3O4 — CID 19805641
2-(3-acetamidopropanoylamino)ethylcarbamic acid (PubChem CID 19805641) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-(3-acetamidopropanoylamino)ethylcarbamic acid.
| Compound Name | 2-(3-acetamidopropanoylamino)ethylcarbamic acid |
|---|---|
| PubChem CID | 19805641 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-(3-acetamidopropanoylamino)ethylcarbamic acid |
| SMILES | CC(=O)NCCC(=O)NCCNC(=O)O |
| InChI | InChI=1S/C8H15N3O4/c1-6(12)9-3-2-7(13)10-4-5-11-8(14)15/h11H,2-5H2,1H3,(H,9,12)(H,10,13)(H,14,15) |
| InChIKey | AMARHVNMSQDESI-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|