C5H10N2O5S — CID 87207145
[3-(methanesulfonamido)-3-oxopropyl]carbamic acid (PubChem CID 87207145) has the molecular formula C5H10N2O5S and a molecular weight of 210.21 g/mol. Its IUPAC name is [3-(methanesulfonamido)-3-oxopropyl]carbamic acid.
| Compound Name | [3-(methanesulfonamido)-3-oxopropyl]carbamic acid |
|---|---|
| PubChem CID | 87207145 |
| Molecular Formula | C5H10N2O5S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | [3-(methanesulfonamido)-3-oxopropyl]carbamic acid |
| SMILES | CS(=O)(=O)NC(=O)CCNC(=O)O |
| InChI | InChI=1S/C5H10N2O5S/c1-13(11,12)7-4(8)2-3-6-5(9)10/h6H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | ZGGXWJKFUFQXNY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |