C13H17ClN2O4S — CID 119051620
3-[[2-(2-chloro-3-methylphenyl)acetyl]amino]-N-methylsulfonylpropanamide (PubChem CID 119051620) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 3-[[2-(2-chloro-3-methylphenyl)acetyl]amino]-N-methylsulfonylpropanamide.
| Compound Name | 3-[[2-(2-chloro-3-methylphenyl)acetyl]amino]-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 119051620 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-[[2-(2-chloro-3-methylphenyl)acetyl]amino]-N-methylsulfonylpropanamide |
| SMILES | Cc1cccc(CC(=O)NCCC(=O)NS(C)(=O)=O)c1Cl |
| InChI | InChI=1S/C13H17ClN2O4S/c1-9-4-3-5-10(13(9)14)8-12(18)15-7-6-11(17)16-21(2,19)20/h3-5H,6-8H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | ILQFQRYUEJVSME-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |