C14H25NO3S — CID 170757170
2,6-dimethyl-N-methylsulfonylbenzamide;ethane (PubChem CID 170757170) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2,6-dimethyl-N-methylsulfonylbenzamide;ethane.
| Compound Name | 2,6-dimethyl-N-methylsulfonylbenzamide;ethane |
|---|---|
| PubChem CID | 170757170 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2,6-dimethyl-N-methylsulfonylbenzamide;ethane |
| SMILES | CC.CC.Cc1cccc(C)c1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C10H13NO3S.2C2H6/c1-7-5-4-6-8(2)9(7)10(12)11-15(3,13)14;2*1-2/h4-6H,1-3H3,(H,11,12);2*1-2H3 |
| InChIKey | GNQYEIJZVPFTST-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |