C11H16N2O3S — CID 170757504
N-(dimethylsulfamoyl)-2,6-dimethylbenzamide (PubChem CID 170757504) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(dimethylsulfamoyl)-2,6-dimethylbenzamide.
| Compound Name | N-(dimethylsulfamoyl)-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 170757504 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-(dimethylsulfamoyl)-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H16N2O3S/c1-8-6-5-7-9(2)10(8)11(14)12-17(15,16)13(3)4/h5-7H,1-4H3,(H,12,14) |
| InChIKey | PPCGYFJOPWQBLG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |