C8H6O5S-2 — CID 20760991
2-methyl-6-sulfonatobenzoate (PubChem CID 20760991) has the molecular formula C8H6O5S-2 and a molecular weight of 214.20 g/mol. Its IUPAC name is 2-methyl-6-sulfonatobenzoate.
| Compound Name | 2-methyl-6-sulfonatobenzoate |
|---|---|
| PubChem CID | 20760991 |
| Molecular Formula | C8H6O5S-2 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 2-methyl-6-sulfonatobenzoate |
| SMILES | Cc1cccc(S(=O)(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C8H8O5S/c1-5-3-2-4-6(14(11,12)13)7(5)8(9)10/h2-4H,1H3,(H,9,10)(H,11,12,13)/p-2 |
| InChIKey | XWOKSGKAPGSACB-UHFFFAOYSA-L |
| XLogP | -0.74 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|