About 2-methylbenzenesulfonate;tetramethylphosphanium
2-methylbenzenesulfonate;tetramethylphosphanium (PubChem CID 22725746) has the molecular formula C11H19O3PS
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-methylbenzenesulfonate;tetramethylphosphanium.
Molecular Properties
| Compound Name | 2-methylbenzenesulfonate;tetramethylphosphanium |
| PubChem CID | 22725746 |
| Molecular Formula | C11H19O3PS |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-methylbenzenesulfonate;tetramethylphosphanium |
| SMILES | C[P+](C)(C)C.Cc1ccccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C7H8O3S.C4H12P/c1-6-4-2-3-5-7(6)11(8,9)10;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);1-4H3/q;+1/p-1 |
| InChIKey | NDAQSKDERXBAJX-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzenesulfonate;tetramethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzenesulfonate;tetramethylphosphanium?
The IUPAC name of 2-methylbenzenesulfonate;tetramethylphosphanium (CID 22725746) is 2-methylbenzenesulfonate;tetramethylphosphanium.
What is the SMILES notation for 2-methylbenzenesulfonate;tetramethylphosphanium?
The canonical SMILES for 2-methylbenzenesulfonate;tetramethylphosphanium is C[P+](C)(C)C.Cc1ccccc1S(=O)(=O)[O-].
What is the InChIKey of 2-methylbenzenesulfonate;tetramethylphosphanium?
The InChIKey is NDAQSKDERXBAJX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.C4H12P/c1-6-4-2-3-5-7(6)11(8,9)10;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);1-4H3/q;+1/p-1.
What are the key properties of 2-methylbenzenesulfonate;tetramethylphosphanium?
2-methylbenzenesulfonate;tetramethylphosphanium has a molecular weight of 262.31 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenesulfonate;tetramethylphosphanium is sourced from PubChem (CID 22725746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).