About 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium
2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium (PubChem CID 23112877) has the molecular formula C25H19Cl3O3S2
and a molecular weight of 537.92 g/mol. Its IUPAC name is 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium.
Molecular Properties
| Compound Name | 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium |
| PubChem CID | 23112877 |
| Molecular Formula | C25H19Cl3O3S2 |
| Molecular Weight | 537.92 g/mol |
| Exact Mass | 535.98 |
| IUPAC Name | 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium |
| SMILES | Cc1ccccc1S(=O)(=O)[O-].Clc1ccccc1[S+](c1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C18H12Cl3S.C7H8O3S/c19-13-7-1-4-10-16(13)22(17-11-5-2-8-14(17)20)18-12-6-3-9-15(18)21;1-6-4-2-3-5-7(6)11(8,9)10/h1-12H;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | XBAVPUOSEIVDMY-UHFFFAOYSA-M |
| XLogP | 7.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.92 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium?
The IUPAC name of 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium (CID 23112877) is 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium.
What is the SMILES notation for 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium?
The canonical SMILES for 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium is Cc1ccccc1S(=O)(=O)[O-].Clc1ccccc1[S+](c1ccccc1Cl)c1ccccc1Cl.
What is the InChIKey of 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium?
The InChIKey is XBAVPUOSEIVDMY-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H12Cl3S.C7H8O3S/c19-13-7-1-4-10-16(13)22(17-11-5-2-8-14(17)20)18-12-6-3-9-15(18)21;1-6-4-2-3-5-7(6)11(8,9)10/h1-12H;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium?
2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium has a molecular weight of 537.92 g/mol, XLogP of 7.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenesulfonate;tris(2-chlorophenyl)sulfanium is sourced from PubChem (CID 23112877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).