C18H27N3O3S — CID 139118117
diaminomethylideneazanium;2-methylbenzenesulfonate;1,2,3,4-tetramethylbenzene (PubChem CID 139118117) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is diaminomethylideneazanium;2-methylbenzenesulfonate;1,2,3,4-tetramethylbenzene.
| Compound Name | diaminomethylideneazanium;2-methylbenzenesulfonate;1,2,3,4-tetramethylbenzene |
|---|---|
| PubChem CID | 139118117 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | diaminomethylideneazanium;2-methylbenzenesulfonate;1,2,3,4-tetramethylbenzene |
| SMILES | Cc1ccc(C)c(C)c1C.Cc1ccccc1S(=O)(=O)[O-].NC(N)=[NH2+] |
| InChI | InChI=1S/C10H14.C7H8O3S.CH5N3/c1-7-5-6-8(2)10(4)9(7)3;1-6-4-2-3-5-7(6)11(8,9)10;2-1(3)4/h5-6H,1-4H3;2-5H,1H3,(H,8,9,10);(H5,2,3,4) |
| InChIKey | IOGMUXUUZCHRDQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 134.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|