About 2-chlorobenzenesulfonate;rubidium(1+)
2-chlorobenzenesulfonate;rubidium(1+) (PubChem CID 139842295) has the molecular formula C6H4ClO3RbS
and a molecular weight of 277.08 g/mol. Its IUPAC name is 2-chlorobenzenesulfonate;rubidium(1+).
Molecular Properties
| Compound Name | 2-chlorobenzenesulfonate;rubidium(1+) |
| PubChem CID | 139842295 |
| Molecular Formula | C6H4ClO3RbS |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 275.87 |
| IUPAC Name | 2-chlorobenzenesulfonate;rubidium(1+) |
| SMILES | O=S(=O)([O-])c1ccccc1Cl.[Rb+] |
| InChI | InChI=1S/C6H5ClO3S.Rb/c7-5-3-1-2-4-6(5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1 |
| InChIKey | GIFXNDQNZWYCNA-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobenzenesulfonate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzenesulfonate;rubidium(1+)?
The IUPAC name of 2-chlorobenzenesulfonate;rubidium(1+) (CID 139842295) is 2-chlorobenzenesulfonate;rubidium(1+).
What is the SMILES notation for 2-chlorobenzenesulfonate;rubidium(1+)?
The canonical SMILES for 2-chlorobenzenesulfonate;rubidium(1+) is O=S(=O)([O-])c1ccccc1Cl.[Rb+].
What is the InChIKey of 2-chlorobenzenesulfonate;rubidium(1+)?
The InChIKey is GIFXNDQNZWYCNA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5ClO3S.Rb/c7-5-3-1-2-4-6(5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1.
What are the key properties of 2-chlorobenzenesulfonate;rubidium(1+)?
2-chlorobenzenesulfonate;rubidium(1+) has a molecular weight of 277.08 g/mol, XLogP of -1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzenesulfonate;rubidium(1+) is sourced from PubChem (CID 139842295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).