About potassium;2-chlorobenzenesulfonic acid;hydride
potassium;2-chlorobenzenesulfonic acid;hydride (PubChem CID 173108093) has the molecular formula C6H6ClKO3S
and a molecular weight of 232.73 g/mol. Its IUPAC name is potassium;2-chlorobenzenesulfonic acid;hydride.
Molecular Properties
| Compound Name | potassium;2-chlorobenzenesulfonic acid;hydride |
| PubChem CID | 173108093 |
| Molecular Formula | C6H6ClKO3S |
| Molecular Weight | 232.73 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | potassium;2-chlorobenzenesulfonic acid;hydride |
| SMILES | O=S(=O)(O)c1ccccc1Cl.[H-].[K+] |
| InChI | InChI=1S/C6H5ClO3S.K.H/c7-5-3-1-2-4-6(5)11(8,9)10;;/h1-4H,(H,8,9,10);;/q;+1;-1 |
| InChIKey | ZAPWDHHDOREQDH-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.73 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-chlorobenzenesulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-chlorobenzenesulfonic acid;hydride?
The IUPAC name of potassium;2-chlorobenzenesulfonic acid;hydride (CID 173108093) is potassium;2-chlorobenzenesulfonic acid;hydride.
What is the SMILES notation for potassium;2-chlorobenzenesulfonic acid;hydride?
The canonical SMILES for potassium;2-chlorobenzenesulfonic acid;hydride is O=S(=O)(O)c1ccccc1Cl.[H-].[K+].
What is the InChIKey of potassium;2-chlorobenzenesulfonic acid;hydride?
The InChIKey is ZAPWDHHDOREQDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO3S.K.H/c7-5-3-1-2-4-6(5)11(8,9)10;;/h1-4H,(H,8,9,10);;/q;+1;-1.
What are the key properties of potassium;2-chlorobenzenesulfonic acid;hydride?
potassium;2-chlorobenzenesulfonic acid;hydride has a molecular weight of 232.73 g/mol, XLogP of -1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-chlorobenzenesulfonic acid;hydride is sourced from PubChem (CID 173108093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).