C6H5Cl2NaO3S — CID 173175851
sodium;2,4-dichlorobenzenesulfonic acid;hydride (PubChem CID 173175851) has the molecular formula C6H5Cl2NaO3S and a molecular weight of 251.07 g/mol. Its IUPAC name is sodium;2,4-dichlorobenzenesulfonic acid;hydride.
| Compound Name | sodium;2,4-dichlorobenzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173175851 |
| Molecular Formula | C6H5Cl2NaO3S |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.92 |
| IUPAC Name | sodium;2,4-dichlorobenzenesulfonic acid;hydride |
| SMILES | O=S(=O)(O)c1ccc(Cl)cc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C6H4Cl2O3S.Na.H/c7-4-1-2-6(5(8)3-4)12(9,10)11;;/h1-3H,(H,9,10,11);;/q;+1;-1 |
| InChIKey | VOGYLFGIXNXIKT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|