About CID 87064436
CID 87064436 (PubChem CID 87064436) has the molecular formula C6H4Cl2NaO3S
and a molecular weight of 250.06 g/mol.
Molecular Properties
| Compound Name | CID 87064436 |
| PubChem CID | 87064436 |
| Molecular Formula | C6H4Cl2NaO3S |
| Molecular Weight | 250.06 g/mol |
| Exact Mass | 248.92 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(Cl)ccc1Cl.[Na] |
| InChI | InChI=1S/C6H4Cl2O3S.Na/c7-4-1-2-5(8)6(3-4)12(9,10)11;/h1-3H,(H,9,10,11); |
| InChIKey | BFPLFSYTCIDIQS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.06 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87064436 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87064436?
The IUPAC name of CID 87064436 (CID 87064436) is not available.
What is the SMILES notation for CID 87064436?
The canonical SMILES for CID 87064436 is O=S(=O)(O)c1cc(Cl)ccc1Cl.[Na].
What is the InChIKey of CID 87064436?
The InChIKey is BFPLFSYTCIDIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2O3S.Na/c7-4-1-2-5(8)6(3-4)12(9,10)11;/h1-3H,(H,9,10,11);.
What are the key properties of CID 87064436?
CID 87064436 has a molecular weight of 250.06 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87064436 is sourced from PubChem (CID 87064436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).