C12H8Cl2NaO6S2 — CID 172759722
CID 172759722 (PubChem CID 172759722) has the molecular formula C12H8Cl2NaO6S2 and a molecular weight of 406.22 g/mol.
| Compound Name | CID 172759722 |
|---|---|
| PubChem CID | 172759722 |
| Molecular Formula | C12H8Cl2NaO6S2 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 404.90 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(-c2ccc(Cl)c(S(=O)(=O)O)c2)ccc1Cl.[Na] |
| InChI | InChI=1S/C12H8Cl2O6S2.Na/c13-9-3-1-7(5-11(9)21(15,16)17)8-2-4-10(14)12(6-8)22(18,19)20;/h1-6H,(H,15,16,17)(H,18,19,20); |
| InChIKey | LNBFADFYCSFXJU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|