C12H14N2O6S2 — CID 59059894
2-amino-5-[4-amino-3-(trihydroxy-λ4-sulfanyl)phenyl]benzenesulfonic acid (PubChem CID 59059894) has the molecular formula C12H14N2O6S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-amino-5-[4-amino-3-(trihydroxy-λ4-sulfanyl)phenyl]benzenesulfonic acid.
| Compound Name | 2-amino-5-[4-amino-3-(trihydroxy-λ4-sulfanyl)phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59059894 |
| Molecular Formula | C12H14N2O6S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-amino-5-[4-amino-3-(trihydroxy-λ4-sulfanyl)phenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(-c2ccc(N)c(S(=O)(=O)O)c2)cc1S(O)(O)O |
| InChI | InChI=1S/C12H14N2O6S2/c13-9-3-1-7(5-11(9)21(15,16)17)8-2-4-10(14)12(6-8)22(18,19)20/h1-6,15-17H,13-14H2,(H,18,19,20) |
| InChIKey | CVLRNZBVEIMGNE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|