C15H22N4O5S — CID 144898588
2,5-diaminobenzenesulfonic acid;2,5-diaminobenzoic acid;ethane (PubChem CID 144898588) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2,5-diaminobenzenesulfonic acid;2,5-diaminobenzoic acid;ethane.
| Compound Name | 2,5-diaminobenzenesulfonic acid;2,5-diaminobenzoic acid;ethane |
|---|---|
| PubChem CID | 144898588 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2,5-diaminobenzenesulfonic acid;2,5-diaminobenzoic acid;ethane |
| SMILES | CC.Nc1ccc(N)c(C(=O)O)c1.Nc1ccc(N)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C7H8N2O2.C6H8N2O3S.C2H6/c8-4-1-2-6(9)5(3-4)7(10)11;7-4-1-2-5(8)6(3-4)12(9,10)11;1-2/h1-3H,8-9H2,(H,10,11);1-3H,7-8H2,(H,9,10,11);1-2H3 |
| InChIKey | DGPPMHJSJJYABC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 195.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|