C13H16AlN2O3S — CID 175222790
CID 175222790 (PubChem CID 175222790) has the molecular formula C13H16AlN2O3S and a molecular weight of 307.33 g/mol.
| Compound Name | CID 175222790 |
|---|---|
| PubChem CID | 175222790 |
| Molecular Formula | C13H16AlN2O3S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1.Nc1ccc(S(=O)(=O)O)c(N)c1.[Al] |
| InChI | InChI=1S/C7H8.C6H8N2O3S.Al/c1-7-5-3-2-4-6-7;7-4-1-2-6(5(8)3-4)12(9,10)11;/h2-6H,1H3;1-3H,7-8H2,(H,9,10,11); |
| InChIKey | VGOAIQBJZMMYMH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|