C14H18N4O5S — CID 19831477
N-(3-aminophenyl)-2-hydroxyacetamide;2,4-diaminobenzenesulfonic acid (PubChem CID 19831477) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-hydroxyacetamide;2,4-diaminobenzenesulfonic acid.
| Compound Name | N-(3-aminophenyl)-2-hydroxyacetamide;2,4-diaminobenzenesulfonic acid |
|---|---|
| PubChem CID | 19831477 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(3-aminophenyl)-2-hydroxyacetamide;2,4-diaminobenzenesulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)c(N)c1.Nc1cccc(NC(=O)CO)c1 |
| InChI | InChI=1S/C8H10N2O2.C6H8N2O3S/c9-6-2-1-3-7(4-6)10-8(12)5-11;7-4-1-2-6(5(8)3-4)12(9,10)11/h1-4,11H,5,9H2,(H,10,12);1-3H,7-8H2,(H,9,10,11) |
| InChIKey | XOBZDFPGEQRQMX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|