C12H18N2O5S2 — CID 63658124
N-(3-aminophenyl)-3-(2-methylsulfonylethylsulfonyl)propanamide (PubChem CID 63658124) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(3-aminophenyl)-3-(2-methylsulfonylethylsulfonyl)propanamide.
| Compound Name | N-(3-aminophenyl)-3-(2-methylsulfonylethylsulfonyl)propanamide |
|---|---|
| PubChem CID | 63658124 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-(3-aminophenyl)-3-(2-methylsulfonylethylsulfonyl)propanamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)CCC(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-20(16,17)7-8-21(18,19)6-5-12(15)14-11-4-2-3-10(13)9-11/h2-4,9H,5-8,13H2,1H3,(H,14,15) |
| InChIKey | YSUYLKUZODJZSL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|