C13H20N4O3S — CID 62992900
N-(3-aminophenyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide (PubChem CID 62992900) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(3-aminophenyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 62992900 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-(3-aminophenyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CS(=O)(=O)N1CCN(CC(=O)Nc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C13H20N4O3S/c1-21(19,20)17-7-5-16(6-8-17)10-13(18)15-12-4-2-3-11(14)9-12/h2-4,9H,5-8,10,14H2,1H3,(H,15,18) |
| InChIKey | IXPRIUWHVABVJQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|