C16H25ClN4O3S — CID 17426375
N-(3-chlorophenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide (PubChem CID 17426375) has the molecular formula C16H25ClN4O3S and a molecular weight of 388.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17426375 |
| Molecular Formula | C16H25ClN4O3S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-(3-chlorophenyl)-2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H25ClN4O3S/c1-3-20(4-2)25(23,24)21-10-8-19(9-11-21)13-16(22)18-15-7-5-6-14(17)12-15/h5-7,12H,3-4,8-11,13H2,1-2H3,(H,18,22) |
| InChIKey | QQEPIYCMPMDYQV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |