C17H26ClN5O4S — CID 55498911
4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N,N-diethylpiperazine-1-sulfonamide (PubChem CID 55498911) has the molecular formula C17H26ClN5O4S and a molecular weight of 431.95 g/mol. Its IUPAC name is 4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N,N-diethylpiperazine-1-sulfonamide.
| Compound Name | 4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N,N-diethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55498911 |
| Molecular Formula | C17H26ClN5O4S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N,N-diethylpiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)NNC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H26ClN5O4S/c1-3-22(4-2)28(26,27)23-11-9-21(10-12-23)13-16(24)19-20-17(25)14-7-5-6-8-15(14)18/h5-8H,3-4,9-13H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | VHWROSHWFAZOHG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|