C10H22N4O3S — CID 47017445
2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide (PubChem CID 47017445) has the molecular formula C10H22N4O3S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 47017445 |
| Molecular Formula | C10H22N4O3S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C10H22N4O3S/c1-3-13(4-2)18(16,17)14-7-5-12(6-8-14)9-10(11)15/h3-9H2,1-2H3,(H2,11,15) |
| InChIKey | QQRODALUZHVUMB-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |