C16H34N8O4Pb — CID 163474801
λ2-plumbane;2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 163474801) has the molecular formula C16H34N8O4Pb and a molecular weight of 614.49 g/mol. Its IUPAC name is λ2-plumbane;2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | λ2-plumbane;2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 163474801 |
| Molecular Formula | C16H34N8O4Pb |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | λ2-plumbane;2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | NC(=O)CN1CCN(CC(N)=O)CCN(CC(N)=O)CCN(CC(N)=O)CC1.[212PbH2] |
| InChI | InChI=1S/C16H32N8O4.Pb.2H/c17-13(25)9-21-1-2-22(10-14(18)26)5-6-24(12-16(20)28)8-7-23(4-3-21)11-15(19)27;;;/h1-12H2,(H2,17,25)(H2,18,26)(H2,19,27)(H2,20,28);;;/i;1+5;; |
| InChIKey | BZOHQIXPSYVDDP-KBKCWVBXSA-N |
| XLogP | -5.77 |
| TPSA | 185.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |